EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H42O4 |
| Net Charge | 0 |
| Average Mass | 358.563 |
| Monoisotopic Mass | 358.30831 |
| SMILES | O=C(O)C[C@H](O)CCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C21H42O4/c22-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-20(23)19-21(24)25/h20,22-23H,1-19H2,(H,24,25)/t20-/m1/s1 |
| InChIKey | IYEIGJVVRFAXMM-HXUWFJFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3,21-dihydroxyhenicosanoic acid (CHEBI:79294) has functional parent 21-hydroxyhenicosanoic acid (CHEBI:79195) |
| (3R)-3,21-dihydroxyhenicosanoic acid (CHEBI:79294) is a (3R)-3-hydroxy fatty acid (CHEBI:85678) |
| (3R)-3,21-dihydroxyhenicosanoic acid (CHEBI:79294) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (3R)-3,21-dihydroxyhenicosanoic acid (CHEBI:79294) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| Incoming Relation(s) |
| bhos#38 (CHEBI:79269) has functional parent (3R)-3,21-dihydroxyhenicosanoic acid (CHEBI:79294) |
| IUPAC Name |
|---|
| (3R)-3,21-dihydroxyhenicosanoic acid |