EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H32O3 |
| Net Charge | 0 |
| Average Mass | 284.440 |
| Monoisotopic Mass | 284.23514 |
| SMILES | O=C(O)/C=C/CCCCCCCCCCCCCCO |
| InChI | InChI=1S/C17H32O3/c18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17(19)20/h13,15,18H,1-12,14,16H2,(H,19,20)/b15-13+ |
| InChIKey | NLNJBCNCLWUPKI-FYWRMAATSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-17-hydroxyheptadec-2-enoic acid (CHEBI:79175) has functional parent (2E)-2-heptadecenoic acid (CHEBI:79000) |
| (2E)-17-hydroxyheptadec-2-enoic acid (CHEBI:79175) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E)-17-hydroxyheptadec-2-enoic acid (CHEBI:79175) is a straight-chain fatty acid (CHEBI:59202) |
| (2E)-17-hydroxyheptadec-2-enoic acid (CHEBI:79175) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2E)-17-hydroxyheptadec-2-enoic acid (CHEBI:79175) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| Incoming Relation(s) |
| oscr#29 (CHEBI:79151) has functional parent (2E)-17-hydroxyheptadec-2-enoic acid (CHEBI:79175) |
| IUPAC Names |
|---|
| (2E)-17-hydroxyheptadec-2-enoic acid |
| (E)-17-hydroxyheptadec-2-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18655793 | Reaxys |