EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H42O6 |
| Net Charge | 0 |
| Average Mass | 414.583 |
| Monoisotopic Mass | 414.29814 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCCCCC/C=C/C(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H42O6/c1-19-20(24)18-21(25)23(29-19)28-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-22(26)27/h14,16,19-21,23-25H,2-13,15,17-18H2,1H3,(H,26,27)/b16-14+/t19-,20+,21+,23+/m0/s1 |
| InChIKey | HJPCXYKWUOGDSW-KRSIWRBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in maoc-1(hj13),and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#29 (CHEBI:79151) has functional parent (2E)-17-hydroxyheptadec-2-enoic acid (CHEBI:79175) |
| oscr#29 (CHEBI:79151) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#29 (CHEBI:79151) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| oscr#29 (CHEBI:79151) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#29 (CHEBI:79151) is conjugate acid of oscr#29(1−) (CHEBI:140022) |
| Incoming Relation(s) |
| oscr#29-CoA (CHEBI:140023) has functional parent oscr#29 (CHEBI:79151) |
| oscr#29(1−) (CHEBI:140022) is conjugate base of oscr#29 (CHEBI:79151) |
| IUPAC Name |
|---|
| (2E)-17-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heptadec-2-enoic acid |
| Synonym | Source |
|---|---|
| 17-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-heptadecenoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2329 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233459 | Reaxys |
| CAS:1355682-31-3 | SMID |
| Citations |
|---|