EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O3 |
| Net Charge | 0 |
| Average Mass | 270.413 |
| Monoisotopic Mass | 270.21949 |
| SMILES | O=C(O)/C=C/CCCCCCCCCCCCCO |
| InChI | InChI=1S/C16H30O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h12,14,17H,1-11,13,15H2,(H,18,19)/b14-12+ |
| InChIKey | YSNNTXAJZMWJCI-WYMLVPIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-16-hydroxyhexadec-2-enoic acid (CHEBI:79170) has functional parent (E)-hexadec-2-enoic acid (CHEBI:37252) |
| (2E)-16-hydroxyhexadec-2-enoic acid (CHEBI:79170) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E)-16-hydroxyhexadec-2-enoic acid (CHEBI:79170) is a straight-chain fatty acid (CHEBI:59202) |
| (2E)-16-hydroxyhexadec-2-enoic acid (CHEBI:79170) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2E)-16-hydroxyhexadec-2-enoic acid (CHEBI:79170) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| Incoming Relation(s) |
| oscr#27 (CHEBI:79149) has functional parent (2E)-16-hydroxyhexadec-2-enoic acid (CHEBI:79170) |
| IUPAC Name |
|---|
| (2E)-16-hydroxyhexadec-2-enoic acid |
| Synonym | Source |
|---|---|
| trans-16-hydroxyhexadec-2-enoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18655792 | Reaxys |