EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H40O6 |
| Net Charge | 0 |
| Average Mass | 400.556 |
| Monoisotopic Mass | 400.28249 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCCCC/C=C/C(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H40O6/c1-18-19(23)17-20(24)22(28-18)27-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-21(25)26/h13,15,18-20,22-24H,2-12,14,16-17H2,1H3,(H,25,26)/b15-13+/t18-,19+,20+,22+/m0/s1 |
| InChIKey | BEKLYIAFACFFDO-UPBMBJRSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in maoc-1(hj13), and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#27 (CHEBI:79149) has functional parent (2E)-16-hydroxyhexadec-2-enoic acid (CHEBI:79170) |
| oscr#27 (CHEBI:79149) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#27 (CHEBI:79149) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| oscr#27 (CHEBI:79149) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#27 (CHEBI:79149) is conjugate acid of oscr#27(1−) (CHEBI:140016) |
| Incoming Relation(s) |
| oscr#27-CoA (CHEBI:140017) has functional parent oscr#27 (CHEBI:79149) |
| oscr#27(1−) (CHEBI:140016) is conjugate base of oscr#27 (CHEBI:79149) |
| IUPAC Name |
|---|
| (2E)-16-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hexadec-2-enoic acid |
| Synonym | Source |
|---|---|
| 16-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-hexadecenoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2327 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233447 | Reaxys |
| CAS:1355682-27-7 | SMID |
| Citations |
|---|