EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O3 |
| Net Charge | 0 |
| Average Mass | 258.402 |
| Monoisotopic Mass | 258.21949 |
| SMILES | O=C(O)CCCCCCCCCCCCCCO |
| InChI | InChI=1S/C15H30O3/c16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15(17)18/h16H,1-14H2,(H,17,18) |
| InChIKey | BZUNJUAMQZRJIP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-hydroxypentadecanoic acid (CHEBI:79169) has functional parent pentadecanoic acid (CHEBI:42504) |
| 15-hydroxypentadecanoic acid (CHEBI:79169) is a straight-chain saturated fatty acid (CHEBI:39418) |
| 15-hydroxypentadecanoic acid (CHEBI:79169) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 15-hydroxypentadecanoic acid (CHEBI:79169) is conjugate acid of 15-hydroxypentadecanoate (CHEBI:84203) |
| Incoming Relation(s) |
| (3R)-3,15-dihydroxypentadecanoic acid (CHEBI:79282) has functional parent 15-hydroxypentadecanoic acid (CHEBI:79169) |
| 15-hydroxypentadecanoyl-CoA (CHEBI:85211) has functional parent 15-hydroxypentadecanoic acid (CHEBI:79169) |
| oscr#26 (CHEBI:79148) has functional parent 15-hydroxypentadecanoic acid (CHEBI:79169) |
| 15-hydroxypentadecanoate (CHEBI:84203) is conjugate base of 15-hydroxypentadecanoic acid (CHEBI:79169) |
| IUPAC Name |
|---|
| 15-hydroxypentadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050182 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1240100 | Reaxys |
| CAS:4617-33-8 | ChemIDplus |