EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H40O6 |
| Net Charge | 0 |
| Average Mass | 388.545 |
| Monoisotopic Mass | 388.28249 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C21H40O6/c1-17-18(22)16-19(23)21(27-17)26-15-13-11-9-7-5-3-2-4-6-8-10-12-14-20(24)25/h17-19,21-23H,2-16H2,1H3,(H,24,25)/t17-,18+,19+,21+/m0/s1 |
| InChIKey | PWLVZSHZFIGCNL-QEUVDIPISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) worms and also in acox-1(ok2257), maoc-1(hj13), daf-22(ok693), and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#26 (CHEBI:79148) has functional parent 15-hydroxypentadecanoic acid (CHEBI:79169) |
| oscr#26 (CHEBI:79148) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#26 (CHEBI:79148) is a monocarboxylic acid (CHEBI:25384) |
| oscr#26 (CHEBI:79148) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#26 (CHEBI:79148) is conjugate acid of oscr#26(1−) (CHEBI:140013) |
| Incoming Relation(s) |
| bhos#26 (CHEBI:79263) has functional parent oscr#26 (CHEBI:79148) |
| oscr#26-CoA (CHEBI:140014) has functional parent oscr#26 (CHEBI:79148) |
| oscr#26(1−) (CHEBI:140013) is conjugate base of oscr#26 (CHEBI:79148) |
| IUPAC Name |
|---|
| 15-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]pentadecanoic acid |
| Synonym | Source |
|---|---|
| 15-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-pentadecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2326 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233449 | Reaxys |
| CAS:1355682-25-5 | SMID |
| Citations |
|---|