EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O4 |
| Net Charge | 0 |
| Average Mass | 274.401 |
| Monoisotopic Mass | 274.21441 |
| SMILES | O=C(O)C[C@H](O)CCCCCCCCCCCCO |
| InChI | InChI=1S/C15H30O4/c16-12-10-8-6-4-2-1-3-5-7-9-11-14(17)13-15(18)19/h14,16-17H,1-13H2,(H,18,19)/t14-/m1/s1 |
| InChIKey | LFADRGDRPYEYAX-CQSZACIVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3,15-dihydroxypentadecanoic acid (CHEBI:79282) has functional parent 15-hydroxypentadecanoic acid (CHEBI:79169) |
| (3R)-3,15-dihydroxypentadecanoic acid (CHEBI:79282) is a (3R)-3-hydroxy fatty acid (CHEBI:85678) |
| (3R)-3,15-dihydroxypentadecanoic acid (CHEBI:79282) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (3R)-3,15-dihydroxypentadecanoic acid (CHEBI:79282) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| Incoming Relation(s) |
| bhos#26 (CHEBI:79263) has functional parent (3R)-3,15-dihydroxypentadecanoic acid (CHEBI:79282) |
| ibho#26 (CHEBI:79376) has functional parent (3R)-3,15-dihydroxypentadecanoic acid (CHEBI:79282) |
| IUPAC Name |
|---|
| (3R)-3,15-dihydroxypentadecanoic acid |