EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O3 |
| Net Charge | 0 |
| Average Mass | 256.386 |
| Monoisotopic Mass | 256.20384 |
| SMILES | O=C(O)/C=C/CCCCCCCCCCCCO |
| InChI | InChI=1S/C15H28O3/c16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15(17)18/h11,13,16H,1-10,12,14H2,(H,17,18)/b13-11+ |
| InChIKey | ZVRQKBZSJNBTCW-ACCUITESSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-15-hydroxypentadec-2-enoic acid (CHEBI:79168) has functional parent trans-2-pentadecenoic acid (CHEBI:78992) |
| (2E)-15-hydroxypentadec-2-enoic acid (CHEBI:79168) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E)-15-hydroxypentadec-2-enoic acid (CHEBI:79168) is a straight-chain fatty acid (CHEBI:59202) |
| (2E)-15-hydroxypentadec-2-enoic acid (CHEBI:79168) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2E)-15-hydroxypentadec-2-enoic acid (CHEBI:79168) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| Incoming Relation(s) |
| oscr#25 (CHEBI:79147) has functional parent (2E)-15-hydroxypentadec-2-enoic acid (CHEBI:79168) |
| IUPAC Name |
|---|
| (2E)-15-hydroxypentadec-2-enoic acid |
| Synonym | Source |
|---|---|
| trans-15-hydroxypentadec-2-enoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18655790 | Reaxys |