EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O2 |
| Net Charge | 0 |
| Average Mass | 240.387 |
| Monoisotopic Mass | 240.20893 |
| SMILES | CCCCCCCCCCCC/C=C/C(=O)O |
| InChI | InChI=1S/C15H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h13-14H,2-12H2,1H3,(H,16,17)/b14-13+ |
| InChIKey | HOGWBMWOBRRKCD-BUHFOSPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-2-pentadecenoic acid (CHEBI:78992) is a pentadecenoic acid (CHEBI:75088) |
| trans-2-pentadecenoic acid (CHEBI:78992) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| (2E,14R)-14-hydroxypentadec-2-enoic acid (CHEBI:78991) has functional parent trans-2-pentadecenoic acid (CHEBI:78992) |
| (2E)-15-hydroxypentadec-2-enoic acid (CHEBI:79168) has functional parent trans-2-pentadecenoic acid (CHEBI:78992) |
| IUPAC Name |
|---|
| (2E)-pentadec-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030052 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1774135 | Reaxys |