EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O3 |
| Net Charge | 0 |
| Average Mass | 160.213 |
| Monoisotopic Mass | 160.10994 |
| SMILES | O=C(O)CCCCCCCO |
| InChI | InChI=1S/C8H16O3/c9-7-5-3-1-2-4-6-8(10)11/h9H,1-7H2,(H,10,11) |
| InChIKey | KDMSVYIHKLZKET-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-hydroxyoctanoic acid (CHEBI:79162) has functional parent octanoic acid (CHEBI:28837) |
| 8-hydroxyoctanoic acid (CHEBI:79162) is a straight-chain fatty acid (CHEBI:59202) |
| 8-hydroxyoctanoic acid (CHEBI:79162) is a ω-hydroxy-medium-chain fatty acid (CHEBI:194303) |
| Incoming Relation(s) |
| mono(7-carboxyheptyl) phthalate (CHEBI:132739) has functional parent 8-hydroxyoctanoic acid (CHEBI:79162) |
| oscr#14 (CHEBI:79136) has functional parent 8-hydroxyoctanoic acid (CHEBI:79162) |
| IUPAC Name |
|---|
| 8-hydroxyoctanoic acid |
| Synonyms | Source |
|---|---|
| 8-hydroxycaprylic acid | ChEBI |
| ω-hydroxycaprylic acid | ChEBI |
| ω-hydroxyoctanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050023 | LIPID MAPS |