EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H26O6 |
| Net Charge | 0 |
| Average Mass | 290.356 |
| Monoisotopic Mass | 290.17294 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C14H26O6/c1-10-11(15)9-12(16)14(20-10)19-8-6-4-2-3-5-7-13(17)18/h10-12,14-16H,2-9H2,1H3,(H,17,18)/t10-,11+,12+,14+/m0/s1 |
| InChIKey | DJYKCDSAKUJQRP-FMCLSXCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) and is a major ascaroside in acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#14 (CHEBI:79136) has functional parent 8-hydroxyoctanoic acid (CHEBI:79162) |
| oscr#14 (CHEBI:79136) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#14 (CHEBI:79136) is a monocarboxylic acid (CHEBI:25384) |
| oscr#14 (CHEBI:79136) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#14 (CHEBI:79136) is conjugate acid of oscr#14(1−) (CHEBI:139975) |
| Incoming Relation(s) |
| oscr#14-CoA (CHEBI:139976) has functional parent oscr#14 (CHEBI:79136) |
| oscr#14(1−) (CHEBI:139975) is conjugate base of oscr#14 (CHEBI:79136) |
| IUPAC Name |
|---|
| 8-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]octanoic acid |
| Synonym | Source |
|---|---|
| 8-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-octanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2314 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233392 | Reaxys |
| CAS:1355681-99-0 | SMID |
| Citations |
|---|