EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O6 |
| Net Charge | 0 |
| Average Mass | 308.330 |
| Monoisotopic Mass | 308.12599 |
| SMILES | O=C(O)CCCCCCCOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C16H20O6/c17-14(18)10-4-2-1-3-7-11-22-16(21)13-9-6-5-8-12(13)15(19)20/h5-6,8-9H,1-4,7,10-11H2,(H,17,18)(H,19,20) |
| InChIKey | MVSRWFURCUZTAM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mono(7-carboxyheptyl) phthalate (CHEBI:132739) has functional parent 8-hydroxyoctanoic acid (CHEBI:79162) |
| mono(7-carboxyheptyl) phthalate (CHEBI:132739) is a phthalic acid monoester (CHEBI:132610) |
| IUPAC Name |
|---|
| 2-{[(7-carboxyheptyl)oxy]carbonyl}benzoic acid |
| Synonyms | Source |
|---|---|
| mono-7-carboxyheptyl phthalate | ChEBI |
| 1,2-benzenedicarboxylic acid, mono-7-carboxyheptyl ester | ChEBI |
| 1,2-benzenedicarboxylic acid, mono(7-carboxyheptyl) ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:856869-57-3 | ChEBI |