EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO5 |
| Net Charge | 0 |
| Average Mass | 219.237 |
| Monoisotopic Mass | 219.11067 |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13) |
| InChIKey | GHOKWGTUZJEAQD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pantothenic acid (CHEBI:7916) has role plant metabolite (CHEBI:76924) |
| pantothenic acid (CHEBI:7916) is a pantothenic acids (CHEBI:25848) |
| pantothenic acid (CHEBI:7916) is conjugate acid of pantothenate (CHEBI:16454) |
| Incoming Relation(s) |
| pantethine (CHEBI:31959) has functional parent pantothenic acid (CHEBI:7916) |
| (R)-pantothenic acid (CHEBI:46905) is a pantothenic acid (CHEBI:7916) |
| pantothenate (CHEBI:16454) is conjugate base of pantothenic acid (CHEBI:7916) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoic acid |
| Synonyms | Source |
|---|---|
| N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-β-alanine | ChEBI |
| Pantothenic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00864 | KEGG COMPOUND |
| D07413 | KEGG DRUG |
| DB01783 | DrugBank |
| HMDB0000210 | HMDB |
| Pantothenic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727062 | Reaxys |
| CAS:599-54-2 | ChemIDplus |
| Citations |
|---|