EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16NO5 |
| Net Charge | -1 |
| Average Mass | 218.229 |
| Monoisotopic Mass | 218.10340 |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] |
| InChI | InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/p-1 |
| InChIKey | GHOKWGTUZJEAQD-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pantothenate (CHEBI:16454) has role algal metabolite (CHEBI:84735) |
| pantothenate (CHEBI:16454) is a monocarboxylic acid anion (CHEBI:35757) |
| pantothenate (CHEBI:16454) is conjugate base of pantothenic acid (CHEBI:7916) |
| Incoming Relation(s) |
| (R)-pantothenate (CHEBI:29032) is a pantothenate (CHEBI:16454) |
| pantothenic acid (CHEBI:7916) is conjugate acid of pantothenate (CHEBI:16454) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoate |
| Synonym | Source |
|---|---|
| N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-β-alaninate | ChEBI |
| UniProt Name | Source |
|---|---|
| pantothenate | UniProt |
| Citations |
|---|