EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H42N4O8S2 |
| Net Charge | 0 |
| Average Mass | 554.732 |
| Monoisotopic Mass | 554.24441 |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCSSCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C22H42N4O8S2/c1-21(2,13-27)17(31)19(33)25-7-5-15(29)23-9-11-35-36-12-10-24-16(30)6-8-26-20(34)18(32)22(3,4)14-28/h17-18,27-28,31-32H,5-14H2,1-4H3,(H,23,29)(H,24,30)(H,25,33)(H,26,34)/t17-,18-/m0/s1 |
| InChIKey | DJWYOLJPSHDSAL-ROUUACIJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pantethine (CHEBI:31959) has functional parent pantothenic acid (CHEBI:7916) |
| pantethine (CHEBI:31959) has role coenzyme (CHEBI:23354) |
| pantethine (CHEBI:31959) has role nutraceutical (CHEBI:50733) |
| pantethine (CHEBI:31959) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| (2R,2'R)-N,N'-{disulfanediylbis[ethane-2,1-diylimino(3-oxopropane-3,1-diyl)]}bis(2,4-dihydroxy-3,3-dimethylbutanamide) |
| Synonyms | Source |
|---|---|
| Bis(pantothenamidoethyl) disulfide | ChemIDplus |
| D-Bis(N-pantothenyl-beta-aminoethyl) disulfide | ChemIDplus |
| N-[2-[2-[2-[3-[(2,4-dihydroxy-3,3-dimethyl-butanoyl)amino]propanoylamino]ethyldisulfanyl]ethylcarbamoyl]ethyl]-2,4-dihydroxy-3,3-dimethyl-butanamide | HMDB |
| Pantetina | ChemIDplus |
| Pantomin | ChemIDplus |
| (R-(R*,R*))-N,N'-(Dithiobis(ethyleneimino(3-oxopropane-3,1-diyl)))bis(2,4-dihydroxy-3,3-dimethylbutyramide) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3417 | DrugCentral |
| C12661 | KEGG COMPOUND |
| D01234 | KEGG DRUG |
| HMDB0003828 | HMDB |
| Pantethine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1718252 | Reaxys |
| CAS:16816-67-4 | KEGG COMPOUND |
| CAS:16816-67-4 | ChemIDplus |
| Citations |
|---|