EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H32O6 |
| Net Charge | 0 |
| Average Mass | 332.437 |
| Monoisotopic Mass | 332.21989 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C17H32O6/c1-13-14(18)12-15(19)17(23-13)22-11-9-7-5-3-2-4-6-8-10-16(20)21/h13-15,17-19H,2-12H2,1H3,(H,20,21)/t13-,14+,15+,17+/m0/s1 |
| InChIKey | GEMAYWCAMMUVTD-KLZNWCGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) worms. It is a major ascaroside in acox-1(ok2257) mutant worms, and has also been detected in maoc-1(hj13) and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#18 (CHEBI:79140) has functional parent 11-hydroxyundecanoic acid (CHEBI:79126) |
| oscr#18 (CHEBI:79140) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#18 (CHEBI:79140) is a monocarboxylic acid (CHEBI:25384) |
| oscr#18 (CHEBI:79140) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#18 (CHEBI:79140) is conjugate acid of oscr#18(1−) (CHEBI:139987) |
| Incoming Relation(s) |
| bhos#18 (CHEBI:79259) has functional parent oscr#18 (CHEBI:79140) |
| icos#18 (CHEBI:79124) has functional parent oscr#18 (CHEBI:79140) |
| oscr#18-CoA (CHEBI:139988) has functional parent oscr#18 (CHEBI:79140) |
| oscr#18(1−) (CHEBI:139987) is conjugate base of oscr#18 (CHEBI:79140) |
| IUPAC Name |
|---|
| 11-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]undecanoic acid |
| Synonym | Source |
|---|---|
| 11-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-undecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2318 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233409 | Reaxys |
| CAS:1355682-09-5 | SMID |
| Citations |
|---|