EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H31O6 |
| Net Charge | -1 |
| Average Mass | 331.429 |
| Monoisotopic Mass | 331.21261 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCC(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C17H32O6/c1-13-14(18)12-15(19)17(23-13)22-11-9-7-5-3-2-4-6-8-10-16(20)21/h13-15,17-19H,2-12H2,1H3,(H,20,21)/p-1/t13-,14+,15+,17+/m0/s1 |
| InChIKey | GEMAYWCAMMUVTD-KLZNWCGWSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#18(1−) (CHEBI:139987) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#18(1−) (CHEBI:139987) is conjugate base of oscr#18 (CHEBI:79140) |
| Incoming Relation(s) |
| oscr#18 (CHEBI:79140) is conjugate acid of oscr#18(1−) (CHEBI:139987) |
| IUPAC Name |
|---|
| 11-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]undecanoate |