EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37NO7 |
| Net Charge | 0 |
| Average Mass | 475.582 |
| Monoisotopic Mass | 475.25700 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCC(=O)O)[C@H](O)C[C@H]1OC(=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C26H37NO7/c1-18-23(34-25(31)20-17-27-21-13-10-9-12-19(20)21)16-22(28)26(33-18)32-15-11-7-5-3-2-4-6-8-14-24(29)30/h9-10,12-13,17-18,22-23,26-28H,2-8,11,14-16H2,1H3,(H,29,30)/t18-,22+,23+,26+/m0/s1 |
| InChIKey | XUHBKQAFWINXBW-BXAZGIKQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8), acox-1(ok2257), and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icos#18 (CHEBI:79124) has functional parent 11-hydroxyundecanoic acid (CHEBI:79126) |
| icos#18 (CHEBI:79124) has functional parent oscr#18 (CHEBI:79140) |
| icos#18 (CHEBI:79124) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| icos#18 (CHEBI:79124) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| icos#18 (CHEBI:79124) is a monocarboxylic acid (CHEBI:25384) |
| icos#18 (CHEBI:79124) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| IUPAC Name |
|---|
| 11-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}undecanoic acid |
| Synonym | Source |
|---|---|
| 11-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-undecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| icos%2318 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233493 | Reaxys |
| CAS:1355683-18-9 | SMID |
| Citations |
|---|