EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O6 |
| Net Charge | 0 |
| Average Mass | 318.410 |
| Monoisotopic Mass | 318.20424 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H30O6/c1-12-13(17)11-14(18)16(22-12)21-10-8-6-4-2-3-5-7-9-15(19)20/h12-14,16-18H,2-11H2,1H3,(H,19,20)/t12-,13+,14+,16+/m0/s1 |
| InChIKey | KRXDKQWKJIZPMU-DSJMHWKBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8), maoc-1(hj13), and acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#16 (CHEBI:79138) has functional parent 10-hydroxycapric acid (CHEBI:17409) |
| oscr#16 (CHEBI:79138) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#16 (CHEBI:79138) is a monocarboxylic acid (CHEBI:25384) |
| oscr#16 (CHEBI:79138) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#16 (CHEBI:79138) is conjugate acid of oscr#16(1−) (CHEBI:139981) |
| Incoming Relation(s) |
| bhos#16 (CHEBI:79258) has functional parent oscr#16 (CHEBI:79138) |
| oscr#16-CoA (CHEBI:139982) has functional parent oscr#16 (CHEBI:79138) |
| oscr#16(1−) (CHEBI:139981) is conjugate base of oscr#16 (CHEBI:79138) |
| IUPAC Name |
|---|
| 10-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]decanoic acid |
| Synonym | Source |
|---|---|
| 10-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-decanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2316 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233404 | Reaxys |
| CAS:1355682-05-1 | SMID |
| Citations |
|---|