EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H64N7O21P3S |
| Net Charge | 0 |
| Average Mass | 1067.936 |
| Monoisotopic Mass | 1067.30888 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2OP(=O)(O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C37H64N7O21P3S/c1-22-23(45)17-24(46)36(62-22)59-15-10-8-6-4-5-7-9-11-27(48)69-16-14-39-26(47)12-13-40-34(51)31(50)37(2,3)19-61-68(57,58)65-67(55,56)60-18-25-30(64-66(52,53)54)29(49)35(63-25)44-21-43-28-32(38)41-20-42-33(28)44/h20-25,29-31,35-36,45-46,49-50H,4-19H2,1-3H3,(H,39,47)(H,40,51)(H,55,56)(H,57,58)(H2,38,41,42)(H2,52,53,54)/t22-,23+,24+,25+,29+,30+,31-,35+,36+/m0/s1 |
| InChIKey | IWCGIYWOOJAKFW-RDOYHACNSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#16-CoA (CHEBI:139982) has functional parent oscr#16 (CHEBI:79138) |
| oscr#16-CoA (CHEBI:139982) is a acyl-CoA (CHEBI:17984) |
| oscr#16-CoA (CHEBI:139982) is conjugate acid of oscr#16-CoA(4−) (CHEBI:139983) |
| Incoming Relation(s) |
| oscr#16-CoA(4−) (CHEBI:139983) is conjugate base of oscr#16-CoA (CHEBI:139982) |
| Synonyms | Source |
|---|---|
| 10-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]decanoyl-CoA | ChEBI |
| 10-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]decanoyl-coenzyme A | ChEBI |
| oscr#16-coenzyme A | ChEBI |