EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H29O6 |
| Net Charge | -1 |
| Average Mass | 317.402 |
| Monoisotopic Mass | 317.19696 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCC(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H30O6/c1-12-13(17)11-14(18)16(22-12)21-10-8-6-4-2-3-5-7-9-15(19)20/h12-14,16-18H,2-11H2,1H3,(H,19,20)/p-1/t12-,13+,14+,16+/m0/s1 |
| InChIKey | KRXDKQWKJIZPMU-DSJMHWKBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#16(1−) (CHEBI:139981) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#16(1−) (CHEBI:139981) is conjugate base of oscr#16 (CHEBI:79138) |
| Incoming Relation(s) |
| oscr#16 (CHEBI:79138) is conjugate acid of oscr#16(1−) (CHEBI:139981) |
| IUPAC Name |
|---|
| 10-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]decanoate |