EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H60N7O21P3S |
| Net Charge | 0 |
| Average Mass | 1039.882 |
| Monoisotopic Mass | 1039.27758 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2OP(=O)(O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C35H60N7O21P3S/c1-20-21(43)15-22(44)34(60-20)57-13-8-6-4-5-7-9-25(46)67-14-12-37-24(45)10-11-38-32(49)29(48)35(2,3)17-59-66(55,56)63-65(53,54)58-16-23-28(62-64(50,51)52)27(47)33(61-23)42-19-41-26-30(36)39-18-40-31(26)42/h18-23,27-29,33-34,43-44,47-48H,4-17H2,1-3H3,(H,37,45)(H,38,49)(H,53,54)(H,55,56)(H2,36,39,40)(H2,50,51,52)/t20-,21+,22+,23+,27+,28+,29-,33+,34+/m0/s1 |
| InChIKey | LNESMCNAVCENOY-VWQWRKPCSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#14-CoA (CHEBI:139976) has functional parent oscr#14 (CHEBI:79136) |
| oscr#14-CoA (CHEBI:139976) is a acyl-CoA (CHEBI:17984) |
| oscr#14-CoA (CHEBI:139976) is conjugate acid of oscr#14-CoA(4−) (CHEBI:139977) |
| Incoming Relation(s) |
| oscr#14-CoA(4−) (CHEBI:139977) is conjugate base of oscr#14-CoA (CHEBI:139976) |
| Synonyms | Source |
|---|---|
| 8-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]octanoyl-CoA | ChEBI |
| 8-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]octanoyl-coenzyme A | ChEBI |
| oscr#14-coenzyme A | ChEBI |