EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O6 |
| Net Charge | 0 |
| Average Mass | 262.302 |
| Monoisotopic Mass | 262.14164 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C12H22O6/c1-8-9(13)7-10(14)12(18-8)17-6-4-2-3-5-11(15)16/h8-10,12-14H,2-7H2,1H3,(H,15,16)/t8-,9+,10+,12+/m0/s1 |
| InChIKey | OEQPWGGFCAQFGJ-BTQIBKBOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) worms and dhs-28(hj8), maoc-1(hj13), and acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#12 (CHEBI:79135) has functional parent 6-hydroxyhexanoic acid (CHEBI:17869) |
| oscr#12 (CHEBI:79135) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#12 (CHEBI:79135) is a monocarboxylic acid (CHEBI:25384) |
| oscr#12 (CHEBI:79135) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#12 (CHEBI:79135) is conjugate acid of oscr#12(1−) (CHEBI:139968) |
| Incoming Relation(s) |
| oscr#12-CoA (CHEBI:139969) has functional parent oscr#12 (CHEBI:79135) |
| oscr#12(1−) (CHEBI:139968) is conjugate base of oscr#12 (CHEBI:79135) |
| IUPAC Name |
|---|
| 6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hexanoic acid |
| Synonym | Source |
|---|---|
| 6-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-hexanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2312 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233386 | Reaxys |
| CAS:1355681-93-4 | SMID |
| Citations |
|---|