EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21O6 |
| Net Charge | -1 |
| Average Mass | 261.294 |
| Monoisotopic Mass | 261.13436 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCC(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C12H22O6/c1-8-9(13)7-10(14)12(18-8)17-6-4-2-3-5-11(15)16/h8-10,12-14H,2-7H2,1H3,(H,15,16)/p-1/t8-,9+,10+,12+/m0/s1 |
| InChIKey | OEQPWGGFCAQFGJ-BTQIBKBOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#12(1−) (CHEBI:139968) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#12(1−) (CHEBI:139968) is conjugate base of oscr#12 (CHEBI:79135) |
| Incoming Relation(s) |
| oscr#12 (CHEBI:79135) is conjugate acid of oscr#12(1−) (CHEBI:139968) |
| IUPAC Name |
|---|
| 6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hexanoate |