EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H56N7O21P3S |
| Net Charge | 0 |
| Average Mass | 1011.828 |
| Monoisotopic Mass | 1011.24628 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2OP(=O)(O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C33H56N7O21P3S/c1-18-19(41)13-20(42)32(58-18)55-11-6-4-5-7-23(44)65-12-10-35-22(43)8-9-36-30(47)27(46)33(2,3)15-57-64(53,54)61-63(51,52)56-14-21-26(60-62(48,49)50)25(45)31(59-21)40-17-39-24-28(34)37-16-38-29(24)40/h16-21,25-27,31-32,41-42,45-46H,4-15H2,1-3H3,(H,35,43)(H,36,47)(H,51,52)(H,53,54)(H2,34,37,38)(H2,48,49,50)/t18-,19+,20+,21+,25+,26+,27-,31+,32+/m0/s1 |
| InChIKey | JQSJPRMRKRGXEJ-BFRJETTRSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#12-CoA (CHEBI:139969) has functional parent oscr#12 (CHEBI:79135) |
| oscr#12-CoA (CHEBI:139969) is a acyl-CoA (CHEBI:17984) |
| oscr#12-CoA (CHEBI:139969) is conjugate acid of oscr#12-CoA(4−) (CHEBI:139970) |
| Incoming Relation(s) |
| oscr#12-CoA(4−) (CHEBI:139970) is conjugate base of oscr#12-CoA (CHEBI:139969) |
| Synonyms | Source |
|---|---|
| 6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hexanoyl-CoA | ChEBI |
| 6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hexanoyl-coenzyme A | ChEBI |
| oscr#12-coenzyme A | ChEBI |