EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31NO7 |
| Net Charge | 0 |
| Average Mass | 445.512 |
| Monoisotopic Mass | 445.21005 |
| SMILES | C[C@H](CCCC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2cnc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C24H31NO7/c1-15(9-5-3-4-6-12-22(27)28)30-24-20(26)13-21(16(2)31-24)32-23(29)18-14-25-19-11-8-7-10-17(18)19/h6-8,10-12,14-16,20-21,24-26H,3-5,9,13H2,1-2H3,(H,27,28)/b12-6+/t15-,16+,20-,21-,24-/m1/s1 |
| InChIKey | MHHAGCKXSLPDOU-SUOYGWGXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icas#3 (CHEBI:79052) has functional parent (2E,8R)-8-hydroxynon-2-enoic acid (CHEBI:78819) |
| icas#3 (CHEBI:79052) has functional parent ascr#3 (CHEBI:78821) |
| icas#3 (CHEBI:79052) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| icas#3 (CHEBI:79052) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| icas#3 (CHEBI:79052) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| icas#3 (CHEBI:79052) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E,8R)-8-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}non-2-enoic acid |
| Synonym | Source |
|---|---|
| 8R-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-nonenoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| icas%233%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233454 | Reaxys |
| CAS:1355681-39-8 | SMID |
| Citations |
|---|