EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O6 |
| Net Charge | 0 |
| Average Mass | 302.367 |
| Monoisotopic Mass | 302.17294 |
| SMILES | C[C@H](CCCC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H26O6/c1-10(7-5-3-4-6-8-14(18)19)20-15-13(17)9-12(16)11(2)21-15/h6,8,10-13,15-17H,3-5,7,9H2,1-2H3,(H,18,19)/b8-6+/t10-,11+,12-,13-,15-/m1/s1 |
| InChIKey | MWGRRKDIJLJLMO-OSYKULTDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (18650807) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#3 (CHEBI:78821) has functional parent (2E,8R)-8-hydroxynon-2-enoic acid (CHEBI:78819) |
| ascr#3 (CHEBI:78821) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#3 (CHEBI:78821) has role pheromone (CHEBI:26013) |
| ascr#3 (CHEBI:78821) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#3 (CHEBI:78821) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| ascr#3 (CHEBI:78821) is conjugate acid of ascr#3(1-) (CHEBI:139677) |
| Incoming Relation(s) |
| ascr#3-CoA (CHEBI:139705) has functional parent ascr#3 (CHEBI:78821) |
| glas#3 (CHEBI:79300) has functional parent ascr#3 (CHEBI:78821) |
| hbas#3 (CHEBI:79321) has functional parent ascr#3 (CHEBI:78821) |
| icas#3 (CHEBI:79052) has functional parent ascr#3 (CHEBI:78821) |
| mbas#3 (CHEBI:79128) has functional parent ascr#3 (CHEBI:78821) |
| ascr#3(1-) (CHEBI:139677) is conjugate base of ascr#3 (CHEBI:78821) |
| IUPAC Name |
|---|
| (2E,8R)-8-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]non-2-enoic acid |
| Synonyms | Source |
|---|---|
| daumone-3 | SMID |
| (−)-8R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-nonenoic acid | SMID |
| ascaroside C9 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ascr%233 | SMID |
| 17226059 | ChemSpider |
| LMFA13040004 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233393 | Reaxys |
| CAS:946524-26-1 | SMID |
| Citations |
|---|