EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H31O2 |
| Net Charge | -1 |
| Average Mass | 267.433 |
| Monoisotopic Mass | 267.23295 |
| SMILES | CCCCCC/C=C\CCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C17H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h7-8H,2-6,9-16H2,1H3,(H,18,19)/p-1/b8-7- |
| InChIKey | GDTXICBNEOEPAZ-FPLPWBNLSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (10Z)-heptadecenoate (CHEBI:78990) has role plant metabolite (CHEBI:76924) |
| (10Z)-heptadecenoate (CHEBI:78990) is a 10-heptadecenoate (CHEBI:133736) |
| (10Z)-heptadecenoate (CHEBI:78990) is conjugate base of (10Z)-heptadecenoic acid (CHEBI:75094) |
| Incoming Relation(s) |
| 1-(10Z-heptadecenoyl)-2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:156344) has functional parent (10Z)-heptadecenoate (CHEBI:78990) |
| 1-(10Z-heptadecenoyl)-2-hexadecanoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:156345) has functional parent (10Z)-heptadecenoate (CHEBI:78990) |
| (10Z)-heptadecenoic acid (CHEBI:75094) is conjugate acid of (10Z)-heptadecenoate (CHEBI:78990) |
| IUPAC Name |
|---|
| (10Z)-heptadec-10-enoate |
| Synonym | Source |
|---|---|
| cis-10-heptadecenoate | ChEBI |
| Citations |
|---|