EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H32O2 |
| Net Charge | 0 |
| Average Mass | 268.441 |
| Monoisotopic Mass | 268.24023 |
| SMILES | CCCCCC/C=C\CCCCCCCCC(=O)O |
| InChI | InChI=1S/C17H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h7-8H,2-6,9-16H2,1H3,(H,18,19)/b8-7- |
| InChIKey | GDTXICBNEOEPAZ-FPLPWBNLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (10Z)-heptadecenoic acid (CHEBI:75094) has role plant metabolite (CHEBI:76924) |
| (10Z)-heptadecenoic acid (CHEBI:75094) is a 10-heptadecenoic acid (CHEBI:75098) |
| (10Z)-heptadecenoic acid (CHEBI:75094) is conjugate acid of (10Z)-heptadecenoate (CHEBI:78990) |
| Incoming Relation(s) |
| (10Z)-heptadecenoate (CHEBI:78990) is conjugate base of (10Z)-heptadecenoic acid (CHEBI:75094) |
| IUPAC Name |
|---|
| (10Z)-heptadec-10-enoic acid |
| Synonyms | Source |
|---|---|
| (10Z)-10-Heptadecenoic acid | HMDB |
| (10Z)-heptadec-10-enoic acid | HMDB |
| 10Z-heptadecenoic acid | LIPID MAPS |
| cis-tetradec-10-enoic acid | ChEBI |
| C17:1 n-7 cis | ChEBI |
| 17:1 n-7 cis | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060038 | HMDB |
| LMFA01030283 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4670597 | Reaxys |
| Citations |
|---|