EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H31O2 |
| Net Charge | -1 |
| Average Mass | 267.433 |
| Monoisotopic Mass | 267.23295 |
| SMILES | [H]C(CCCCCC)=C([H])CCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C17H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h7-8H,2-6,9-16H2,1H3,(H,18,19)/p-1 |
| InChIKey | GDTXICBNEOEPAZ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-heptadecenoate (CHEBI:133736) is a long-chain fatty acid anion (CHEBI:57560) |
| 10-heptadecenoate (CHEBI:133736) is a monounsaturated fatty acid anion (CHEBI:82680) |
| 10-heptadecenoate (CHEBI:133736) is conjugate base of 10-heptadecenoic acid (CHEBI:75098) |
| Incoming Relation(s) |
| (10Z)-heptadecenoate (CHEBI:78990) is a 10-heptadecenoate (CHEBI:133736) |
| 10-heptadecenoic acid (CHEBI:75098) is conjugate acid of 10-heptadecenoate (CHEBI:133736) |
| IUPAC Name |
|---|
| heptadec-10-enoate |
| Synonym | Source |
|---|---|
| 17:1n7 | ChEBI |