EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O6 |
| Net Charge | 0 |
| Average Mass | 372.502 |
| Monoisotopic Mass | 372.25119 |
| SMILES | C[C@H](CCCCCCCCC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H36O6/c1-15(25-20-18(22)14-17(21)16(2)26-20)12-10-8-6-4-3-5-7-9-11-13-19(23)24/h11,13,15-18,20-22H,3-10,12,14H2,1-2H3,(H,23,24)/b13-11+/t15-,16+,17-,18-,20-/m1/s1 |
| InChIKey | VZEGHYGOTDETNP-VKEQHCKMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#23 (CHEBI:78961) has functional parent (2E,13R)-13-hydroxytetradec-2-enoic acid (CHEBI:78982) |
| ascr#23 (CHEBI:78961) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#23 (CHEBI:78961) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#23 (CHEBI:78961) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| ascr#23 (CHEBI:78961) is conjugate acid of ascr#23(1-) (CHEBI:139656) |
| Incoming Relation(s) |
| ascr#23(1-) (CHEBI:139656) is conjugate base of ascr#23 (CHEBI:78961) |
| IUPAC Name |
|---|
| (2E,13R)-13-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]tetradec-2-enoic acid |
| Synonym | Source |
|---|---|
| 13R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-tetradecenoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%2323%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233422 | Reaxys |
| CAS:1355681-61-6 | SMID |
| Citations |
|---|