EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35O6 |
| Net Charge | -1 |
| Average Mass | 371.494 |
| Monoisotopic Mass | 371.24391 |
| SMILES | C[C@H](CCCCCCCCC/C=C/C(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H36O6/c1-15(25-20-18(22)14-17(21)16(2)26-20)12-10-8-6-4-3-5-7-9-11-13-19(23)24/h11,13,15-18,20-22H,3-10,12,14H2,1-2H3,(H,23,24)/p-1/b13-11+/t15-,16+,17-,18-,20-/m1/s1 |
| InChIKey | VZEGHYGOTDETNP-VKEQHCKMSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#23(1-) (CHEBI:139656) is a organic molecular entity (CHEBI:50860) |
| ascr#23(1-) (CHEBI:139656) is conjugate base of ascr#23 (CHEBI:78961) |
| Incoming Relation(s) |
| ascr#23 (CHEBI:78961) is conjugate acid of ascr#23(1-) (CHEBI:139656) |