EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O6 |
| Net Charge | 0 |
| Average Mass | 224.168 |
| Monoisotopic Mass | 224.03209 |
| SMILES | O=C1c2ccccc2C(=O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C10H8O6/c11-7-5-3-1-2-4-6(5)8(12)10(15,16)9(7,13)14/h1-4,13-16H |
| InChIKey | CWHBUPIYFIPPRI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | topoisomerase inhibitor An EC 5.99.1.* (miscellaneous isomerase) inhibitor that interferes with the action of any of the topoisomerases (enzymes that regulate the overwinding or underwinding of DNA). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,2,3,3-tetrahydroxy-2,3-dihydronaphthalene-1,4-dione (CHEBI:78857) has functional parent naphthalene-1,2,3,4-tetrone (CHEBI:78854) |
| 2,2,3,3-tetrahydroxy-2,3-dihydronaphthalene-1,4-dione (CHEBI:78857) has role antibacterial agent (CHEBI:33282) |
| 2,2,3,3-tetrahydroxy-2,3-dihydronaphthalene-1,4-dione (CHEBI:78857) has role antipsoriatic (CHEBI:50748) |
| 2,2,3,3-tetrahydroxy-2,3-dihydronaphthalene-1,4-dione (CHEBI:78857) has role topoisomerase inhibitor (CHEBI:70727) |
| 2,2,3,3-tetrahydroxy-2,3-dihydronaphthalene-1,4-dione (CHEBI:78857) is a ketone hydrate (CHEBI:63734) |
| 2,2,3,3-tetrahydroxy-2,3-dihydronaphthalene-1,4-dione (CHEBI:78857) is a tetralins (CHEBI:36786) |
| Synonyms | Source |
|---|---|
| 2,2,3,3-tetrahydroxy-2,3-dihydronaphthalene-1,4-dione | ChEBI |
| 2,3-dihydro-2,2,3,3-tetrahydroxy-1,4-naphthoquinone | ChEBI |
| oxoline | ChEBI |
| oxoline dihydrate | ChEBI |
| Citations |
|---|