EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H4O4 |
| Net Charge | 0 |
| Average Mass | 188.138 |
| Monoisotopic Mass | 188.01096 |
| SMILES | O=c1c(=O)c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C10H4O4/c11-7-5-3-1-2-4-6(5)8(12)10(14)9(7)13/h1-4H |
| InChIKey | HZVGIXIRNANSHU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naphthalene-1,2,3,4-tetrone (CHEBI:78854) has role geroprotector (CHEBI:176497) |
| naphthalene-1,2,3,4-tetrone (CHEBI:78854) is a aromatic ketone (CHEBI:76224) |
| naphthalene-1,2,3,4-tetrone (CHEBI:78854) is a tetralins (CHEBI:36786) |
| Incoming Relation(s) |
| 2,2,3,3-tetrahydroxy-2,3-dihydronaphthalene-1,4-dione (CHEBI:78857) has functional parent naphthalene-1,2,3,4-tetrone (CHEBI:78854) |
| IUPAC Name |
|---|
| naphthalene-1,2,3,4-tetrone |
| Synonyms | Source |
|---|---|
| 1,2,3,4-naphthalenetetrone | ChemIDplus |
| 1,2,3,4-tetrahydro-1,2,3,4-tetraoxonaphthalene | ChEBI |
| oksolin | ChemIDplus |
| oxoline | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 147931 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2047003 | Reaxys |
| CAS:30266-58-1 | ChemIDplus |
| Citations |
|---|