EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O6 |
| Net Charge | 0 |
| Average Mass | 262.302 |
| Monoisotopic Mass | 262.14164 |
| SMILES | C[C@H](CCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C12H22O6/c1-7(4-3-5-11(15)16)17-12-10(14)6-9(13)8(2)18-12/h7-10,12-14H,3-6H2,1-2H3,(H,15,16)/t7-,8+,9-,10-,12-/m1/s1 |
| InChIKey | LGGOKKRYYYYXPA-VEOFNUSFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pristionchus pacificus (ncbitaxon:54126) | - | PubMed (23161728) | |
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) and acox-1(ok2257) mutant worms, but absent in daf-22(ok693), dhs-28(hj8), and maoc-1(hj13) mutant worms |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#12 (CHEBI:78841) has functional parent (5R)-5-hydroxyhexanoic acid (CHEBI:78842) |
| ascr#12 (CHEBI:78841) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#12 (CHEBI:78841) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#12 (CHEBI:78841) is a monocarboxylic acid (CHEBI:25384) |
| ascr#12 (CHEBI:78841) is conjugate acid of ascr#12(1−) (CHEBI:139621) |
| Incoming Relation(s) |
| icas#12 (CHEBI:79060) has functional parent ascr#12 (CHEBI:78841) |
| ascr#12(1−) (CHEBI:139621) is conjugate base of ascr#12 (CHEBI:78841) |
| IUPAC Name |
|---|
| (5R)-5-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hexanoic acid |
| Synonyms | Source |
|---|---|
| 5R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-hexanoic acid | SMID |
| asc-C6 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ascr%2312%0D | SMID |
| LMFA13040038 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233385 | Reaxys |
| CAS:1355681-43-4 | SMID |
| Citations |
|---|