EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | C[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C6H12O3/c1-5(7)3-2-4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | YDCRNMJQROAWFT-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5R)-5-hydroxyhexanoic acid (CHEBI:78842) has functional parent hexanoic acid (CHEBI:30776) |
| (5R)-5-hydroxyhexanoic acid (CHEBI:78842) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| (5R)-5-hydroxyhexanoic acid (CHEBI:78842) is a medium-chain fatty acid (CHEBI:59554) |
| Incoming Relation(s) |
| ascr#12 (CHEBI:78841) has functional parent (5R)-5-hydroxyhexanoic acid (CHEBI:78842) |
| icas#12 (CHEBI:79060) has functional parent (5R)-5-hydroxyhexanoic acid (CHEBI:78842) |
| Synonyms | Source |
|---|---|
| (−)-5-hydroxycaproic acid | ChEBI |
| (−)-5-hydroxyhexanoic acid | ChEBI |
| (5R)-5-hydroxycaproic acid | ChEBI |
| (R)-(−)-5-hydroxyhexanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6130741 | Reaxys |