EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21O6 |
| Net Charge | -1 |
| Average Mass | 261.294 |
| Monoisotopic Mass | 261.13436 |
| SMILES | C[C@H](CCCC(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C12H22O6/c1-7(4-3-5-11(15)16)17-12-10(14)6-9(13)8(2)18-12/h7-10,12-14H,3-6H2,1-2H3,(H,15,16)/p-1/t7-,8+,9-,10-,12-/m1/s1 |
| InChIKey | LGGOKKRYYYYXPA-VEOFNUSFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#12(1−) (CHEBI:139621) is a monocarboxylic acid anion (CHEBI:35757) |
| ascr#12(1−) (CHEBI:139621) is conjugate base of ascr#12 (CHEBI:78841) |
| Incoming Relation(s) |
| icas#12(1−) (CHEBI:229462) has functional parent ascr#12(1−) (CHEBI:139621) |
| ascr#12 (CHEBI:78841) is conjugate acid of ascr#12(1−) (CHEBI:139621) |
| IUPAC Name |
|---|
| (5R)-5-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hexanoate |
| Synonyms | Source |
|---|---|
| asc-C6(1−) | ChEBI |
| asc-C6 anion | ChEBI |
| ascr#12 anion | ChEBI |