EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O3 |
| Net Charge | 0 |
| Average Mass | 146.186 |
| Monoisotopic Mass | 146.09429 |
| SMILES | CC(O)CCCCC(=O)O |
| InChI | InChI=1S/C7H14O3/c1-6(8)4-2-3-5-7(9)10/h6,8H,2-5H2,1H3,(H,9,10) |
| InChIKey | UBIZMIFHVVCVEJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxyheptanoic acid (CHEBI:78774) has functional parent heptanoic acid (CHEBI:45571) |
| 6-hydroxyheptanoic acid (CHEBI:78774) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| 6-hydroxyheptanoic acid (CHEBI:78774) is a medium-chain fatty acid (CHEBI:59554) |
| Incoming Relation(s) |
| (6R)-6-hydroxyheptanoic acid (CHEBI:78775) is a 6-hydroxyheptanoic acid (CHEBI:78774) |
| (6S)-6-hydroxyheptanoic acid (CHEBI:78781) is a 6-hydroxyheptanoic acid (CHEBI:78774) |
| Synonym | Source |
|---|---|
| 6-hydroxy-heptanoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050225 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1752050 | Reaxys |