EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H29NO5 |
| Net Charge | 0 |
| Average Mass | 327.421 |
| Monoisotopic Mass | 327.20457 |
| SMILES | [H][C@]12O[C@H](OCCN)[C@H](C)[C@]3([H])CC[C@@H](C)[C@]4([H])CC[C@@](C)(OO[C@]143)O2 |
| InChI | InChI=1S/C17H29NO5/c1-10-4-5-13-11(2)14(19-9-8-18)20-15-17(13)12(10)6-7-16(3,21-15)22-23-17/h10-15H,4-9,18H2,1-3H3/t10-,11-,12+,13+,14+,15-,16-,17-/m1/s1 |
| InChIKey | HPGHCIXRRLNXRN-XQLAAWPRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-aminoarteether (CHEBI:78567) is a artemisinin derivative (CHEBI:63920) |
| β-aminoarteether (CHEBI:78567) is a primary amino compound (CHEBI:50994) |
| Incoming Relation(s) |
| β-aminoarteether maleate (CHEBI:78570) has part β-aminoarteether (CHEBI:78567) |
| IUPAC Names |
|---|
| 2-{[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-10-yl]oxy}ethanamine |
| 2-[[(3R,5aS,6R,8aS,9R,10S,12R,12aR)-decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-yl]oxy]ethanamine |
| Synonyms | Source |
|---|---|
| 10-(β-aminoethoxy)dihydroartemisinin | ChEBI |
| 2-(10β-dihydroartemisinoxy)ethylamine | ChEBI |
| β-2'-aminoarteether | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7378418 | Reaxys |
| Citations |
|---|