EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H29NO5.C2H2O4 |
| Net Charge | 0 |
| Average Mass | 417.455 |
| Monoisotopic Mass | 417.19988 |
| SMILES | O=C(O)C(=O)O.[H][C@]12O[C@H](OCCN)[C@H](C)[C@]3([H])CC[C@@H](C)[C@]4([H])CC[C@@](C)(OO[C@]143)O2 |
| InChI | InChI=1S/C17H29NO5.C2H2O4/c1-10-4-5-13-11(2)14(19-9-8-18)20-15-17(13)12(10)6-7-16(3,21-15)22-23-17;3-1(4)2(5)6/h10-15H,4-9,18H2,1-3H3;(H,3,4)(H,5,6)/t10-,11-,12+,13+,14+,15-,16-,17-;/m1./s1 |
| InChIKey | CIKUOKKWYDQNML-QKUGCFMISA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-aminoarteether maleate (CHEBI:78570) has part β-aminoarteether (CHEBI:78567) |
| β-aminoarteether maleate (CHEBI:78570) has role allergen (CHEBI:50904) |
| β-aminoarteether maleate (CHEBI:78570) is a maleate salt (CHEBI:50221) |
| IUPAC Names |
|---|
| 2-[[(3R,5aS,6R,8aS,9R,10S,12R,12aR)-decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-yl]oxy]ethanamine ethanedioate (1:1) |
| 2-{[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-10-yl]oxy}ethanamine ethanedioate (1:1) |
| Synonyms | Source |
|---|---|
| SM934 | ChEBI |
| 2-(10β-dihydroartemisinoxy)ethylamine maleate | ChEBI |
| 10-(β-aminoethoxy)dihydroartemisinin maleate | ChEBI |
| β-2'-aminoarteether maleate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18530796 | Reaxys |
| Citations |
|---|