EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O3 |
| Net Charge | -1 |
| Average Mass | 117.124 |
| Monoisotopic Mass | 117.05572 |
| SMILES | CC(O)C(C)C(=O)[O-] |
| InChI | InChI=1S/C5H10O3/c1-3(4(2)6)5(7)8/h3-4,6H,1-2H3,(H,7,8)/p-1 |
| InChIKey | VEXDRERIMPLZLU-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-3-hydroxybutyrate (CHEBI:78554) has functional parent butyrate (CHEBI:17968) |
| 2-methyl-3-hydroxybutyrate (CHEBI:78554) is a hydroxy fatty acid anion (CHEBI:59835) |
| 2-methyl-3-hydroxybutyrate (CHEBI:78554) is conjugate base of 3-hydroxy-2-methylbutanoic acid (CHEBI:37051) |
| Incoming Relation(s) |
| (2S,3S)-3-hydroxy-2-methylbutanoate (CHEBI:78559) is a 2-methyl-3-hydroxybutyrate (CHEBI:78554) |
| 3-hydroxy-2-methylbutanoic acid (CHEBI:37051) is conjugate acid of 2-methyl-3-hydroxybutyrate (CHEBI:78554) |
| IUPAC Name |
|---|
| 3-hydroxy-2-methylbutanoate |
| Synonym | Source |
|---|---|
| 3-hydroxy-2-methylbutyrate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methyl-3-hydroxybutanoate | UniProt |