EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O3 |
| Net Charge | -1 |
| Average Mass | 117.124 |
| Monoisotopic Mass | 117.05572 |
| SMILES | C[C@H](O)[C@H](C)C(=O)[O-] |
| InChI | InChI=1S/C5H10O3/c1-3(4(2)6)5(7)8/h3-4,6H,1-2H3,(H,7,8)/p-1/t3-,4-/m0/s1 |
| InChIKey | VEXDRERIMPLZLU-IMJSIDKUSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3S)-3-hydroxy-2-methylbutanoate (CHEBI:78559) is a 2-methyl-3-hydroxybutyrate (CHEBI:78554) |
| (2S,3S)-3-hydroxy-2-methylbutanoate (CHEBI:78559) is conjugate base of (2S,3S)-3-hydroxy-2-methylbutanoic acid (CHEBI:37052) |
| Incoming Relation(s) |
| (2S,3S)-3-hydroxy-2-methylbutanoic acid (CHEBI:37052) is conjugate acid of (2S,3S)-3-hydroxy-2-methylbutanoate (CHEBI:78559) |
| IUPAC Name |
|---|
| (2S,3S)-3-hydroxy-2-methylbutanoate |
| Synonym | Source |
|---|---|
| (2S,3S)-3-hydroxy-2-methylbutyrate | ChEBI |
| UniProt Name | Source |
|---|---|
| (2S)-methyl-(3S)-hydroxybutanoate | UniProt |