EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | CC(O)C(C)C(=O)O |
| InChI | InChI=1S/C5H10O3/c1-3(4(2)6)5(7)8/h3-4,6H,1-2H3,(H,7,8) |
| InChIKey | VEXDRERIMPLZLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-2-methylbutanoic acid (CHEBI:37051) has functional parent butyric acid (CHEBI:30772) |
| 3-hydroxy-2-methylbutanoic acid (CHEBI:37051) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| 3-hydroxy-2-methylbutanoic acid (CHEBI:37051) is conjugate acid of 2-methyl-3-hydroxybutyrate (CHEBI:78554) |
| Incoming Relation(s) |
| 2-methyl-3-hydroxybutyryl-CoA (CHEBI:165613) has functional parent 3-hydroxy-2-methylbutanoic acid (CHEBI:37051) |
| benzyl 2-methyl-3-hydroxybutanoate (CHEBI:22748) has functional parent 3-hydroxy-2-methylbutanoic acid (CHEBI:37051) |
| (2S,3S)-3-hydroxy-2-methylbutanoic acid (CHEBI:37052) is a 3-hydroxy-2-methylbutanoic acid (CHEBI:37051) |
| 2-methyl-3-hydroxybutyrate (CHEBI:78554) is conjugate base of 3-hydroxy-2-methylbutanoic acid (CHEBI:37051) |
| IUPAC Name |
|---|
| 3-hydroxy-2-methylbutanoic acid |
| Synonyms | Source |
|---|---|
| 2-methyl-3-hydroxybutanoic acid | ChEBI |
| 2-methyl-3-hydroxybutyric acid | ChEBI |
| 3-hydroxy-2-methylbutyric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1747118 | Reaxys |