EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O2S |
| Net Charge | 0 |
| Average Mass | 218.277 |
| Monoisotopic Mass | 218.04015 |
| SMILES | O=S(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10O2S/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | KZTYYGOKRVBIMI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenyl sulfone (CHEBI:78360) has role plant metabolite (CHEBI:76924) |
| diphenyl sulfone (CHEBI:78360) is a sulfone (CHEBI:35850) |
| Incoming Relation(s) |
| 4,4'-sulfonyldiphenol (CHEBI:34372) has functional parent diphenyl sulfone (CHEBI:78360) |
| dapsone (CHEBI:4325) has functional parent diphenyl sulfone (CHEBI:78360) |
| IUPAC Name |
|---|
| diphenyl sulfone |
| Synonyms | Source |
|---|---|
| 1,1'-sulfonyldibenzene | IUPAC |
| Diphenylsulfone | ChemIDplus |
| Sulfobenzide | ChemIDplus |
| bis-(phenyl)-sulfone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Diphenyl_sulfone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1910573 | Reaxys |
| CAS:127-63-9 | ChemIDplus |
| Citations |
|---|