EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O4S |
| Net Charge | 0 |
| Average Mass | 250.275 |
| Monoisotopic Mass | 250.02998 |
| SMILES | O=S(=O)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H10O4S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8,13-14H |
| InChIKey | VPWNQTHUCYMVMZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4'-sulfonyldiphenol (CHEBI:34372) has functional parent diphenyl sulfone (CHEBI:78360) |
| 4,4'-sulfonyldiphenol (CHEBI:34372) has role endocrine disruptor (CHEBI:138015) |
| 4,4'-sulfonyldiphenol (CHEBI:34372) has role metabolite (CHEBI:25212) |
| 4,4'-sulfonyldiphenol (CHEBI:34372) is a bisphenol (CHEBI:22901) |
| 4,4'-sulfonyldiphenol (CHEBI:34372) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 4,4'-sulfonyldiphenol |
| Synonyms | Source |
|---|---|
| 1,1'-Sulfonylbis(4-hydroxybenzene) | KEGG COMPOUND |
| 4,4'-Dihydroxydiphenyl sulfone | ChemIDplus |
| Bis(4-hydroxyphenyl) sulfone | ChemIDplus |
| Bisphenol S | KEGG COMPOUND |
| Bis(p-hydroxyphenyl) sulfone | ChemIDplus |
| DHDPhS | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Bisphenol_S | Wikipedia |
| C14216 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2052954 | Reaxys |
| CAS:80-09-1 | ChemIDplus |
| CAS:80-09-1 | KEGG COMPOUND |
| Citations |
|---|