EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | CCOC(=O)[C@H](C)O |
| InChI | InChI=1S/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3/t4-/m0/s1 |
| InChIKey | LZCLXQDLBQLTDK-BYPYZUCNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl (2S)-lactate (CHEBI:78322) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| ethyl (2S)-lactate (CHEBI:78322) is a ethyl 2-hydroxypropanoate (CHEBI:78321) |
| ethyl (2S)-lactate (CHEBI:78322) is enantiomer of ethyl (2R)-lactate (CHEBI:78323) |
| Incoming Relation(s) |
| rac-ethyl lactate (CHEBI:78319) has part ethyl (2S)-lactate (CHEBI:78322) |
| ethyl (2R)-lactate (CHEBI:78323) is enantiomer of ethyl (2S)-lactate (CHEBI:78322) |
| IUPAC Name |
|---|
| ethyl (2S)-2-hydroxypropanoate |
| Synonyms | Source |
|---|---|
| (L)-(−)-ethyl lactate | ChemIDplus |
| (L)-ethyl lactate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Ethyl_lactate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720839 | Reaxys |
| CAS:687-47-8 | ChemIDplus |