EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O4 |
| Net Charge | 0 |
| Average Mass | 324.461 |
| Monoisotopic Mass | 324.23006 |
| SMILES | CCCCCCCCCCCCCCOc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C19H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-22-18-15-14-17(23-18)19(20)21/h14-15H,2-13,16H2,1H3,(H,20,21) |
| InChIKey | CZRCFAOMWRAFIC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(tetradecyloxy)-2-furoic acid (CHEBI:77936) has functional parent 2-furoic acid (CHEBI:30845) |
| 5-(tetradecyloxy)-2-furoic acid (CHEBI:77936) has role antineoplastic agent (CHEBI:35610) |
| 5-(tetradecyloxy)-2-furoic acid (CHEBI:77936) has role apoptosis inducer (CHEBI:68495) |
| 5-(tetradecyloxy)-2-furoic acid (CHEBI:77936) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| 5-(tetradecyloxy)-2-furoic acid (CHEBI:77936) has role PPARα agonist (CHEBI:70782) |
| 5-(tetradecyloxy)-2-furoic acid (CHEBI:77936) is a aromatic ether (CHEBI:35618) |
| 5-(tetradecyloxy)-2-furoic acid (CHEBI:77936) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 5-(tetradecyloxy)-2-furoic acid |
| Synonyms | Source |
|---|---|
| 5-(Tetradecyloxy)-2-furancarboxylic acid | ChemIDplus |
| 5-Tetradecyloxy-2-furonic acid | ChemIDplus |
| 5-(tetradecyloxy)furan-2-carboxylic acid | ChEBI |
| TOFA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:539681 | Reaxys |
| CAS:54857-86-2 | ChemIDplus |
| Citations |
|---|