EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H5NO2 |
| Net Charge | 0 |
| Average Mass | 75.067 |
| Monoisotopic Mass | 75.03203 |
| SMILES | C/C=[N+](\[O-])O |
| InChI | InChI=1S/C2H5NO2/c1-2-3(4)5/h2H,1H3,(H,4,5) |
| InChIKey | CPZLOQHKKRZRSD-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aci-nitroethane (CHEBI:77894) is a aci-nitro compound (CHEBI:136622) |
| aci-nitroethane (CHEBI:77894) is conjugate acid of aci-nitroethane(1−) (CHEBI:55327) |
| aci-nitroethane (CHEBI:77894) is tautomer of nitroethane (CHEBI:16268) |
| Incoming Relation(s) |
| aci-nitroethane(1−) (CHEBI:55327) is conjugate base of aci-nitroethane (CHEBI:77894) |
| nitroethane (CHEBI:16268) is tautomer of aci-nitroethane (CHEBI:77894) |
| IUPAC Name |
|---|
| ethylideneazinic acid |
| Synonym | Source |
|---|---|
| ethylnitronate ylide | ChEBI |
| UniProt Name | Source |
|---|---|
| ethylnitronate | UniProt |