EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H5NO2 |
| Net Charge | 0 |
| Average Mass | 75.067 |
| Monoisotopic Mass | 75.03203 |
| SMILES | CC[N+](=O)[O-] |
| InChI | InChI=1S/C2H5NO2/c1-2-3(4)5/h2H2,1H3 |
| InChIKey | MCSAJNNLRCFZED-UHFFFAOYSA-N |
| Wikipedia |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitroethane (CHEBI:16268) is a primary nitroalkane (CHEBI:133972) |
| nitroethane (CHEBI:16268) is tautomer of aci-nitroethane (CHEBI:77894) |
| Incoming Relation(s) |
| aci-nitroethane (CHEBI:77894) is tautomer of nitroethane (CHEBI:16268) |
| IUPAC Name |
|---|
| nitroethane |
| Synonyms | Source |
|---|---|
| 1-nitroethane | NIST Chemistry WebBook |
| Nitroethan | ChEBI |
| Nitroethane | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| nitroethane | UniProt |
| Citations |
|---|